C75H75N12O10P — CID 88924316
tris[(2R,3R)-2-[(3-carbamoyl-6-phenylpyrrolo[1,2-b]pyridazin-4-yl)amino]-3-phenylmethoxybutyl] phosphate (PubChem CID 88924316) has the molecular formula C75H75N12O10P and a molecular weight of 1335.47 g/mol. Its IUPAC name is tris[(2R,3R)-2-[(3-carbamoyl-6-phenylpyrrolo[1,2-b]pyridazin-4-yl)amino]-3-phenylmethoxybutyl] phosphate.
| Compound Name | tris[(2R,3R)-2-[(3-carbamoyl-6-phenylpyrrolo[1,2-b]pyridazin-4-yl)amino]-3-phenylmethoxybutyl] phosphate |
|---|---|
| PubChem CID | 88924316 |
| Molecular Formula | C75H75N12O10P |
| Molecular Weight | 1335.47 g/mol |
| Exact Mass | 1334.55 |
| IUPAC Name | tris[(2R,3R)-2-[(3-carbamoyl-6-phenylpyrrolo[1,2-b]pyridazin-4-yl)amino]-3-phenylmethoxybutyl] phosphate |
| SMILES | C[C@@H](OCc1ccccc1)[C@@H](COP(=O)(OC[C@@H](Nc1c(C(N)=O)cnn2cc(-c3ccccc3)cc12)[C@@H](C)OCc1ccccc1)OC[C@@H](Nc1c(C(N)=O)cnn2cc(-c3ccccc3)cc12)[C@@H](C)OCc1ccccc1)Nc1c(C(N)=O)cnn2cc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C75H75N12O10P/c1-49(92-43-52-22-10-4-11-23-52)64(82-70-61(73(76)88)37-79-85-40-58(34-67(70)85)55-28-16-7-17-29-55)46-95-98(91,96-47-65(50(2)93-44-53-24-12-5-13-25-53)83-71-62(74(77)89)38-80-86-41-59(35-68(71)86)56-30-18-8-19-31-56)97-48-66(51(3)94-45-54-26-14-6-15-27-54)84-72-63(75(78)90)39-81-87-42-60(36-69(72)87)57-32-20-9-21-33-57/h4-42,49-51,64-66,82-84H,43-48H2,1-3H3,(H2,76,88)(H2,77,89)(H2,78,90)/t49-,50-,51-,64-,65-,66-/m1/s1 |
| InChIKey | NCLLNJIKNIDCQC-RZKSJKGHSA-N |
| XLogP | 12.64 |
| TPSA | 289.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 98 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1335.47 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|