C31H40FN5O5 — CID 88924376
tert-butyl N-[4-[[4-[(4E)-6-fluoro-4-methoxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl]piperidin-1-yl]methyl]-2-pyridinyl]carbamate (PubChem CID 88924376) has the molecular formula C31H40FN5O5 and a molecular weight of 581.69 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-[(4E)-6-fluoro-4-methoxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl]piperidin-1-yl]methyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-[(4E)-6-fluoro-4-methoxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl]piperidin-1-yl]methyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 88924376 |
| Molecular Formula | C31H40FN5O5 |
| Molecular Weight | 581.69 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | tert-butyl N-[4-[[4-[(4E)-6-fluoro-4-methoxyiminospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl]piperidin-1-yl]methyl]-2-pyridinyl]carbamate |
| SMILES | CO/N=C1\CC2(CCN(C(=O)C3CCN(Cc4ccnc(NC(=O)OC(C)(C)C)c4)CC3)CC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C31H40FN5O5/c1-30(2,3)42-29(39)34-27-17-21(7-12-33-27)20-36-13-8-22(9-14-36)28(38)37-15-10-31(11-16-37)19-25(35-40-4)24-18-23(32)5-6-26(24)41-31/h5-7,12,17-18,22H,8-11,13-16,19-20H2,1-4H3,(H,33,34,39)/b35-25+ |
| InChIKey | OVQDGWBZEOYTIC-KVQDIILNSA-N |
| XLogP | 4.97 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.69 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|