C21H16Cl2F4N2O4 — CID 88924645
[2-[[1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamoyl]-1-ethyl-6-methylindol-5-yl] hydrogen carbonate (PubChem CID 88924645) has the molecular formula C21H16Cl2F4N2O4 and a molecular weight of 507.27 g/mol. Its IUPAC name is [2-[[1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamoyl]-1-ethyl-6-methylindol-5-yl] hydrogen carbonate.
| Compound Name | [2-[[1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamoyl]-1-ethyl-6-methylindol-5-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 88924645 |
| Molecular Formula | C21H16Cl2F4N2O4 |
| Molecular Weight | 507.27 g/mol |
| Exact Mass | 506.04 |
| IUPAC Name | [2-[[1-(3,5-dichloro-4-fluorophenyl)-2,2,2-trifluoroethyl]carbamoyl]-1-ethyl-6-methylindol-5-yl] hydrogen carbonate |
| SMILES | CCn1c(C(=O)NC(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)cc2cc(OC(=O)O)c(C)cc21 |
| InChI | InChI=1S/C21H16Cl2F4N2O4/c1-3-29-14-4-9(2)16(33-20(31)32)8-10(14)7-15(29)19(30)28-18(21(25,26)27)11-5-12(22)17(24)13(23)6-11/h4-8,18H,3H2,1-2H3,(H,28,30)(H,31,32) |
| InChIKey | FYGOMDPAMZCNHE-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.27 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|