About 5-butyl-4,6-dichloro-2-methoxypyrimidine
5-butyl-4,6-dichloro-2-methoxypyrimidine (PubChem CID 88924762) has the molecular formula C9H12Cl2N2O
and a molecular weight of 235.11 g/mol. Its IUPAC name is 5-butyl-4,6-dichloro-2-methoxypyrimidine.
Molecular Properties
| Compound Name | 5-butyl-4,6-dichloro-2-methoxypyrimidine |
| PubChem CID | 88924762 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 5-butyl-4,6-dichloro-2-methoxypyrimidine |
| SMILES | CCCCc1c(Cl)nc(OC)nc1Cl |
| InChI | InChI=1S/C9H12Cl2N2O/c1-3-4-5-6-7(10)12-9(14-2)13-8(6)11/h3-5H2,1-2H3 |
| InChIKey | DLKKHXLIHHDNFB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-butyl-4,6-dichloro-2-methoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-4,6-dichloro-2-methoxypyrimidine?
The IUPAC name of 5-butyl-4,6-dichloro-2-methoxypyrimidine (CID 88924762) is 5-butyl-4,6-dichloro-2-methoxypyrimidine.
What is the SMILES notation for 5-butyl-4,6-dichloro-2-methoxypyrimidine?
The canonical SMILES for 5-butyl-4,6-dichloro-2-methoxypyrimidine is CCCCc1c(Cl)nc(OC)nc1Cl.
What is the InChIKey of 5-butyl-4,6-dichloro-2-methoxypyrimidine?
The InChIKey is DLKKHXLIHHDNFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12Cl2N2O/c1-3-4-5-6-7(10)12-9(14-2)13-8(6)11/h3-5H2,1-2H3.
What are the key properties of 5-butyl-4,6-dichloro-2-methoxypyrimidine?
5-butyl-4,6-dichloro-2-methoxypyrimidine has a molecular weight of 235.11 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-4,6-dichloro-2-methoxypyrimidine is sourced from PubChem (CID 88924762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).