About chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate
chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate (PubChem CID 88924816) has the molecular formula C6H15ClNO6P
and a molecular weight of 263.61 g/mol. Its IUPAC name is chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate.
Molecular Properties
| Compound Name | chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate |
| PubChem CID | 88924816 |
| Molecular Formula | C6H15ClNO6P |
| Molecular Weight | 263.61 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate |
| SMILES | CCOOC(=O)C(C)(C)N.O=P(O)(O)Cl |
| InChI | InChI=1S/C6H13NO3.ClH2O3P/c1-4-9-10-5(8)6(2,3)7;1-5(2,3)4/h4,7H2,1-3H3;(H2,2,3,4) |
| InChIKey | JGZPYOAVUTWFQU-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.61 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate?
The IUPAC name of chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate (CID 88924816) is chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate.
What is the SMILES notation for chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate?
The canonical SMILES for chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate is CCOOC(=O)C(C)(C)N.O=P(O)(O)Cl.
What is the InChIKey of chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate?
The InChIKey is JGZPYOAVUTWFQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3.ClH2O3P/c1-4-9-10-5(8)6(2,3)7;1-5(2,3)4/h4,7H2,1-3H3;(H2,2,3,4).
What are the key properties of chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate?
chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate has a molecular weight of 263.61 g/mol, XLogP of 0.54, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for chlorophosphonic acid;ethyl 2-amino-2-methylpropaneperoxoate is sourced from PubChem (CID 88924816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).