About azanide;benzene;nickel(2+)
azanide;benzene;nickel(2+) (PubChem CID 88925435) has the molecular formula C6H7NNi
and a molecular weight of 151.82 g/mol. Its IUPAC name is azanide;benzene;nickel(2+).
Molecular Properties
| Compound Name | azanide;benzene;nickel(2+) |
| PubChem CID | 88925435 |
| Molecular Formula | C6H7NNi |
| Molecular Weight | 151.82 g/mol |
| Exact Mass | 150.99 |
| IUPAC Name | azanide;benzene;nickel(2+) |
| SMILES | [NH2-].[Ni+2].[c-]1ccccc1 |
| InChI | InChI=1S/C6H5.H2N.Ni/c1-2-4-6-5-3-1;;/h1-5H;1H2;/q2*-1;+2 |
| InChIKey | YUCMEQOEZPEYCK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 33.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.82 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze azanide;benzene;nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanide;benzene;nickel(2+)?
The IUPAC name of azanide;benzene;nickel(2+) (CID 88925435) is azanide;benzene;nickel(2+).
What is the SMILES notation for azanide;benzene;nickel(2+)?
The canonical SMILES for azanide;benzene;nickel(2+) is [NH2-].[Ni+2].[c-]1ccccc1.
What is the InChIKey of azanide;benzene;nickel(2+)?
The InChIKey is YUCMEQOEZPEYCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5.H2N.Ni/c1-2-4-6-5-3-1;;/h1-5H;1H2;/q2*-1;+2.
What are the key properties of azanide;benzene;nickel(2+)?
azanide;benzene;nickel(2+) has a molecular weight of 151.82 g/mol, XLogP of 2.20, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for azanide;benzene;nickel(2+) is sourced from PubChem (CID 88925435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).