About 3-hydroxy-6,6-bis(methylsulfanyl)hexanal
3-hydroxy-6,6-bis(methylsulfanyl)hexanal (PubChem CID 88925739) has the molecular formula C8H16O2S2
and a molecular weight of 208.35 g/mol. Its IUPAC name is 3-hydroxy-6,6-bis(methylsulfanyl)hexanal.
Molecular Properties
| Compound Name | 3-hydroxy-6,6-bis(methylsulfanyl)hexanal |
| PubChem CID | 88925739 |
| Molecular Formula | C8H16O2S2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 3-hydroxy-6,6-bis(methylsulfanyl)hexanal |
| SMILES | CSC(CCC(O)CC=O)SC |
| InChI | InChI=1S/C8H16O2S2/c1-11-8(12-2)4-3-7(10)5-6-9/h6-8,10H,3-5H2,1-2H3 |
| InChIKey | PLHXIMZCPFZWOD-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-6,6-bis(methylsulfanyl)hexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-6,6-bis(methylsulfanyl)hexanal?
The IUPAC name of 3-hydroxy-6,6-bis(methylsulfanyl)hexanal (CID 88925739) is 3-hydroxy-6,6-bis(methylsulfanyl)hexanal.
What is the SMILES notation for 3-hydroxy-6,6-bis(methylsulfanyl)hexanal?
The canonical SMILES for 3-hydroxy-6,6-bis(methylsulfanyl)hexanal is CSC(CCC(O)CC=O)SC.
What is the InChIKey of 3-hydroxy-6,6-bis(methylsulfanyl)hexanal?
The InChIKey is PLHXIMZCPFZWOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2S2/c1-11-8(12-2)4-3-7(10)5-6-9/h6-8,10H,3-5H2,1-2H3.
What are the key properties of 3-hydroxy-6,6-bis(methylsulfanyl)hexanal?
3-hydroxy-6,6-bis(methylsulfanyl)hexanal has a molecular weight of 208.35 g/mol, XLogP of 1.77, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-6,6-bis(methylsulfanyl)hexanal is sourced from PubChem (CID 88925739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).