C27H37N4O4+ — CID 88925748
1,1-bis[4-nitro-2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium (PubChem CID 88925748) has the molecular formula C27H37N4O4+ and a molecular weight of 481.62 g/mol. Its IUPAC name is 1,1-bis[4-nitro-2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium.
| Compound Name | 1,1-bis[4-nitro-2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 88925748 |
| Molecular Formula | C27H37N4O4+ |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 1,1-bis[4-nitro-2,6-di(propan-2-yl)phenyl]-4,5-dihydroimidazol-1-ium |
| SMILES | CC(C)c1cc([N+](=O)[O-])cc(C(C)C)c1[N+]1(c2c(C(C)C)cc([N+](=O)[O-])cc2C(C)C)C=NCC1 |
| InChI | InChI=1S/C27H37N4O4/c1-16(2)22-11-20(29(32)33)12-23(17(3)4)26(22)31(10-9-28-15-31)27-24(18(5)6)13-21(30(34)35)14-25(27)19(7)8/h11-19H,9-10H2,1-8H3/q+1 |
| InChIKey | MISYMMGFDUGTOX-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 98.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|