About (4S)-4-aminoheptan-3-one
(4S)-4-aminoheptan-3-one (PubChem CID 88925772) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is (4S)-4-aminoheptan-3-one.
Molecular Properties
| Compound Name | (4S)-4-aminoheptan-3-one |
| PubChem CID | 88925772 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | (4S)-4-aminoheptan-3-one |
| SMILES | CCC[C@H](N)C(=O)CC |
| InChI | InChI=1S/C7H15NO/c1-3-5-6(8)7(9)4-2/h6H,3-5,8H2,1-2H3/t6-/m0/s1 |
| InChIKey | GJRFTURGHLHALU-LURJTMIESA-N |
| XLogP | 1.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4-aminoheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-aminoheptan-3-one?
The IUPAC name of (4S)-4-aminoheptan-3-one (CID 88925772) is (4S)-4-aminoheptan-3-one.
What is the SMILES notation for (4S)-4-aminoheptan-3-one?
The canonical SMILES for (4S)-4-aminoheptan-3-one is CCC[C@H](N)C(=O)CC.
What is the InChIKey of (4S)-4-aminoheptan-3-one?
The InChIKey is GJRFTURGHLHALU-LURJTMIESA-N. The full InChI is InChI=1S/C7H15NO/c1-3-5-6(8)7(9)4-2/h6H,3-5,8H2,1-2H3/t6-/m0/s1.
What are the key properties of (4S)-4-aminoheptan-3-one?
(4S)-4-aminoheptan-3-one has a molecular weight of 129.20 g/mol, XLogP of 1.09, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-aminoheptan-3-one is sourced from PubChem (CID 88925772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).