About [dimethoxy(methyl)silyl] hexanoate
[dimethoxy(methyl)silyl] hexanoate (PubChem CID 88925975) has the molecular formula C9H20O4Si
and a molecular weight of 220.34 g/mol. Its IUPAC name is [dimethoxy(methyl)silyl] hexanoate.
Molecular Properties
| Compound Name | [dimethoxy(methyl)silyl] hexanoate |
| PubChem CID | 88925975 |
| Molecular Formula | C9H20O4Si |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | [dimethoxy(methyl)silyl] hexanoate |
| SMILES | CCCCCC(=O)O[Si](C)(OC)OC |
| InChI | InChI=1S/C9H20O4Si/c1-5-6-7-8-9(10)13-14(4,11-2)12-3/h5-8H2,1-4H3 |
| InChIKey | ISBLQDQPLCIWKG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [dimethoxy(methyl)silyl] hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dimethoxy(methyl)silyl] hexanoate?
The IUPAC name of [dimethoxy(methyl)silyl] hexanoate (CID 88925975) is [dimethoxy(methyl)silyl] hexanoate.
What is the SMILES notation for [dimethoxy(methyl)silyl] hexanoate?
The canonical SMILES for [dimethoxy(methyl)silyl] hexanoate is CCCCCC(=O)O[Si](C)(OC)OC.
What is the InChIKey of [dimethoxy(methyl)silyl] hexanoate?
The InChIKey is ISBLQDQPLCIWKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O4Si/c1-5-6-7-8-9(10)13-14(4,11-2)12-3/h5-8H2,1-4H3.
What are the key properties of [dimethoxy(methyl)silyl] hexanoate?
[dimethoxy(methyl)silyl] hexanoate has a molecular weight of 220.34 g/mol, XLogP of 1.97, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [dimethoxy(methyl)silyl] hexanoate is sourced from PubChem (CID 88925975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).