About ethylazanium;trifluoromethanesulfonate
ethylazanium;trifluoromethanesulfonate (PubChem CID 88926541) has the molecular formula C3H8F3NO3S
and a molecular weight of 195.16 g/mol. Its IUPAC name is ethylazanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | ethylazanium;trifluoromethanesulfonate |
| PubChem CID | 88926541 |
| Molecular Formula | C3H8F3NO3S |
| Molecular Weight | 195.16 g/mol |
| Exact Mass | 195.02 |
| IUPAC Name | ethylazanium;trifluoromethanesulfonate |
| SMILES | CC[NH3+].O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C2H7N.CHF3O3S/c1-2-3;2-1(3,4)8(5,6)7/h2-3H2,1H3;(H,5,6,7) |
| InChIKey | RZLNQEMIXUBMRI-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.16 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ethylazanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylazanium;trifluoromethanesulfonate?
The IUPAC name of ethylazanium;trifluoromethanesulfonate (CID 88926541) is ethylazanium;trifluoromethanesulfonate.
What is the SMILES notation for ethylazanium;trifluoromethanesulfonate?
The canonical SMILES for ethylazanium;trifluoromethanesulfonate is CC[NH3+].O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of ethylazanium;trifluoromethanesulfonate?
The InChIKey is RZLNQEMIXUBMRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7N.CHF3O3S/c1-2-3;2-1(3,4)8(5,6)7/h2-3H2,1H3;(H,5,6,7).
What are the key properties of ethylazanium;trifluoromethanesulfonate?
ethylazanium;trifluoromethanesulfonate has a molecular weight of 195.16 g/mol, XLogP of -0.70, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethylazanium;trifluoromethanesulfonate is sourced from PubChem (CID 88926541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).