About 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran
3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran (PubChem CID 88926607) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran |
| PubChem CID | 88926607 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran |
| SMILES | C=C/C=C(/C)C1=C(C)COC1 |
| InChI | InChI=1S/C10H14O/c1-4-5-8(2)10-7-11-6-9(10)3/h4-5H,1,6-7H2,2-3H3/b8-5- |
| InChIKey | IFYDQCBBFAJGAE-YVMONPNESA-N |
| XLogP | 2.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran?
The IUPAC name of 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran (CID 88926607) is 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran.
What is the SMILES notation for 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran?
The canonical SMILES for 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran is C=C/C=C(/C)C1=C(C)COC1.
What is the InChIKey of 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran?
The InChIKey is IFYDQCBBFAJGAE-YVMONPNESA-N. The full InChI is InChI=1S/C10H14O/c1-4-5-8(2)10-7-11-6-9(10)3/h4-5H,1,6-7H2,2-3H3/b8-5-.
What are the key properties of 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran?
3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran has a molecular weight of 150.22 g/mol, XLogP of 2.47, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[(2Z)-penta-2,4-dien-2-yl]-2,5-dihydrofuran is sourced from PubChem (CID 88926607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).