C15H28N2O — CID 88926733
1-N'-[(2Z,4Z)-2-(1-methoxyethenyl)hexa-2,4-dienyl]hexane-1,1-diamine (PubChem CID 88926733) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 1-N'-[(2Z,4Z)-2-(1-methoxyethenyl)hexa-2,4-dienyl]hexane-1,1-diamine.
| Compound Name | 1-N'-[(2Z,4Z)-2-(1-methoxyethenyl)hexa-2,4-dienyl]hexane-1,1-diamine |
|---|---|
| PubChem CID | 88926733 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 1-N'-[(2Z,4Z)-2-(1-methoxyethenyl)hexa-2,4-dienyl]hexane-1,1-diamine |
| SMILES | C=C(OC)/C(=C\C=C/C)CNC(N)CCCCC |
| InChI | InChI=1S/C15H28N2O/c1-5-7-9-11-15(16)17-12-14(10-8-6-2)13(3)18-4/h6,8,10,15,17H,3,5,7,9,11-12,16H2,1-2,4H3/b8-6-,14-10- |
| InChIKey | DCLHJRFOKMUSMC-LYORTEKZSA-N |
| XLogP | 3.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|