C21H19FN4OS2 — CID 88926878
2-fluoro-N-(furan-2-ylsulfanyl)-5-[5-(2-methylpyrimidin-4-yl)-2-propan-2-yl-1,3-thiazol-4-yl]aniline (PubChem CID 88926878) has the molecular formula C21H19FN4OS2 and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-fluoro-N-(furan-2-ylsulfanyl)-5-[5-(2-methylpyrimidin-4-yl)-2-propan-2-yl-1,3-thiazol-4-yl]aniline.
| Compound Name | 2-fluoro-N-(furan-2-ylsulfanyl)-5-[5-(2-methylpyrimidin-4-yl)-2-propan-2-yl-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 88926878 |
| Molecular Formula | C21H19FN4OS2 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.10 |
| IUPAC Name | 2-fluoro-N-(furan-2-ylsulfanyl)-5-[5-(2-methylpyrimidin-4-yl)-2-propan-2-yl-1,3-thiazol-4-yl]aniline |
| SMILES | Cc1nccc(-c2sc(C(C)C)nc2-c2ccc(F)c(NSc3ccco3)c2)n1 |
| InChI | InChI=1S/C21H19FN4OS2/c1-12(2)21-25-19(20(28-21)16-8-9-23-13(3)24-16)14-6-7-15(22)17(11-14)26-29-18-5-4-10-27-18/h4-12,26H,1-3H3 |
| InChIKey | QRNSOFMGBOCFOD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|