C16H26IN5O6S2 — CID 88927467
[[1-[1-[1-[3-(2-methoxypropanoylamino)propanoylamino]ethylamino]-1-oxopropan-2-yl]-2,5-dioxopyrrolidin-3-yl]amino]sulfanyl thiohypoiodite (PubChem CID 88927467) has the molecular formula C16H26IN5O6S2 and a molecular weight of 575.45 g/mol. Its IUPAC name is [[1-[1-[1-[3-(2-methoxypropanoylamino)propanoylamino]ethylamino]-1-oxopropan-2-yl]-2,5-dioxopyrrolidin-3-yl]amino]sulfanyl thiohypoiodite.
| Compound Name | [[1-[1-[1-[3-(2-methoxypropanoylamino)propanoylamino]ethylamino]-1-oxopropan-2-yl]-2,5-dioxopyrrolidin-3-yl]amino]sulfanyl thiohypoiodite |
|---|---|
| PubChem CID | 88927467 |
| Molecular Formula | C16H26IN5O6S2 |
| Molecular Weight | 575.45 g/mol |
| Exact Mass | 575.04 |
| IUPAC Name | [[1-[1-[1-[3-(2-methoxypropanoylamino)propanoylamino]ethylamino]-1-oxopropan-2-yl]-2,5-dioxopyrrolidin-3-yl]amino]sulfanyl thiohypoiodite |
| SMILES | COC(C)C(=O)NCCC(=O)NC(C)NC(=O)C(C)N1C(=O)CC(NSSI)C1=O |
| InChI | InChI=1S/C16H26IN5O6S2/c1-8(22-13(24)7-11(16(22)27)21-30-29-17)14(25)20-10(3)19-12(23)5-6-18-15(26)9(2)28-4/h8-11,21H,5-7H2,1-4H3,(H,18,26)(H,19,23)(H,20,25) |
| InChIKey | BGYPPFCANATGMW-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 145.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.45 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|