C25H26N2O6S — CID 88927642
1-(1,3-benzodioxol-5-yl)-N-[4-(ethylperoxymethyl)-5-[(2-methoxyphenyl)methyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide (PubChem CID 88927642) has the molecular formula C25H26N2O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[4-(ethylperoxymethyl)-5-[(2-methoxyphenyl)methyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[4-(ethylperoxymethyl)-5-[(2-methoxyphenyl)methyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 88927642 |
| Molecular Formula | C25H26N2O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[4-(ethylperoxymethyl)-5-[(2-methoxyphenyl)methyl]-1,3-thiazol-2-yl]cyclopropane-1-carboxamide |
| SMILES | CCOOCc1nc(NC(=O)C2(c3ccc4c(c3)OCO4)CC2)sc1Cc1ccccc1OC |
| InChI | InChI=1S/C25H26N2O6S/c1-3-32-33-14-18-22(12-16-6-4-5-7-19(16)29-2)34-24(26-18)27-23(28)25(10-11-25)17-8-9-20-21(13-17)31-15-30-20/h4-9,13H,3,10-12,14-15H2,1-2H3,(H,26,27,28) |
| InChIKey | TYHCAYODLBGINI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|