C25H26F3NO6S — CID 88927705
[13-cyclohexyl-10-(methylperoxymethyl)-6,7-dihydroindolo[1,2-d][1,4]benzoxazepin-4-yl] trifluoromethanesulfonate (PubChem CID 88927705) has the molecular formula C25H26F3NO6S and a molecular weight of 525.55 g/mol. Its IUPAC name is [13-cyclohexyl-10-(methylperoxymethyl)-6,7-dihydroindolo[1,2-d][1,4]benzoxazepin-4-yl] trifluoromethanesulfonate.
| Compound Name | [13-cyclohexyl-10-(methylperoxymethyl)-6,7-dihydroindolo[1,2-d][1,4]benzoxazepin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88927705 |
| Molecular Formula | C25H26F3NO6S |
| Molecular Weight | 525.55 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | [13-cyclohexyl-10-(methylperoxymethyl)-6,7-dihydroindolo[1,2-d][1,4]benzoxazepin-4-yl] trifluoromethanesulfonate |
| SMILES | COOCc1ccc2c(C3CCCCC3)c3n(c2c1)CCOc1c(OS(=O)(=O)C(F)(F)F)cccc1-3 |
| InChI | InChI=1S/C25H26F3NO6S/c1-32-34-15-16-10-11-18-20(14-16)29-12-13-33-24-19(23(29)22(18)17-6-3-2-4-7-17)8-5-9-21(24)35-36(30,31)25(26,27)28/h5,8-11,14,17H,2-4,6-7,12-13,15H2,1H3 |
| InChIKey | ZXHFTADISGYSKO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|