C34H51NO5Si — CID 88927800
(2R,4R)-6-[(2S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]-N,4-dimethoxy-N,2-dimethylhexanamide (PubChem CID 88927800) has the molecular formula C34H51NO5Si and a molecular weight of 581.87 g/mol. Its IUPAC name is (2R,4R)-6-[(2S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]-N,4-dimethoxy-N,2-dimethylhexanamide.
| Compound Name | (2R,4R)-6-[(2S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]-N,4-dimethoxy-N,2-dimethylhexanamide |
|---|---|
| PubChem CID | 88927800 |
| Molecular Formula | C34H51NO5Si |
| Molecular Weight | 581.87 g/mol |
| Exact Mass | 581.35 |
| IUPAC Name | (2R,4R)-6-[(2S)-5-[5-[hydroxy(diphenyl)silyl]-5-methylhexyl]-3-methylideneoxolan-2-yl]-N,4-dimethoxy-N,2-dimethylhexanamide |
| SMILES | C=C1CC(CCCCC(C)(C)[Si](O)(c2ccccc2)c2ccccc2)O[C@H]1CC[C@H](C[C@@H](C)C(=O)N(C)OC)OC |
| InChI | InChI=1S/C34H51NO5Si/c1-26-24-29(40-32(26)22-21-28(38-6)25-27(2)33(36)35(5)39-7)16-14-15-23-34(3,4)41(37,30-17-10-8-11-18-30)31-19-12-9-13-20-31/h8-13,17-20,27-29,32,37H,1,14-16,21-25H2,2-7H3/t27-,28-,29?,32+/m1/s1 |
| InChIKey | JEJLJASUBXSPCZ-JVPSXMLWSA-N |
| XLogP | 5.63 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.87 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|