About hydroxysulfanylmethyl(dimethyl)-λ3-iodane
hydroxysulfanylmethyl(dimethyl)-λ3-iodane (PubChem CID 88927852) has the molecular formula C3H9IOS
and a molecular weight of 220.07 g/mol. Its IUPAC name is hydroxysulfanylmethyl(dimethyl)-λ3-iodane.
Molecular Properties
| Compound Name | hydroxysulfanylmethyl(dimethyl)-λ3-iodane |
| PubChem CID | 88927852 |
| Molecular Formula | C3H9IOS |
| Molecular Weight | 220.07 g/mol |
| Exact Mass | 219.94 |
| IUPAC Name | hydroxysulfanylmethyl(dimethyl)-λ3-iodane |
| SMILES | CI(C)CSO |
| InChI | InChI=1S/C3H9IOS/c1-4(2)3-6-5/h5H,3H2,1-2H3 |
| InChIKey | ZADIVSKMDKDCKR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.07 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydroxysulfanylmethyl(dimethyl)-λ3-iodane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxysulfanylmethyl(dimethyl)-λ3-iodane?
The IUPAC name of hydroxysulfanylmethyl(dimethyl)-λ3-iodane (CID 88927852) is hydroxysulfanylmethyl(dimethyl)-λ3-iodane.
What is the SMILES notation for hydroxysulfanylmethyl(dimethyl)-λ3-iodane?
The canonical SMILES for hydroxysulfanylmethyl(dimethyl)-λ3-iodane is CI(C)CSO.
What is the InChIKey of hydroxysulfanylmethyl(dimethyl)-λ3-iodane?
The InChIKey is ZADIVSKMDKDCKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9IOS/c1-4(2)3-6-5/h5H,3H2,1-2H3.
What are the key properties of hydroxysulfanylmethyl(dimethyl)-λ3-iodane?
hydroxysulfanylmethyl(dimethyl)-λ3-iodane has a molecular weight of 220.07 g/mol, XLogP of 1.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxysulfanylmethyl(dimethyl)-λ3-iodane is sourced from PubChem (CID 88927852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).