C19H31N — CID 88927977
(2Z)-3,7-dimethyl-N-(4-methylpenta-1,3-dien-2-yl)-N-prop-2-enylocta-2,6-dien-1-amine (PubChem CID 88927977) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is (2Z)-3,7-dimethyl-N-(4-methylpenta-1,3-dien-2-yl)-N-prop-2-enylocta-2,6-dien-1-amine.
| Compound Name | (2Z)-3,7-dimethyl-N-(4-methylpenta-1,3-dien-2-yl)-N-prop-2-enylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 88927977 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | (2Z)-3,7-dimethyl-N-(4-methylpenta-1,3-dien-2-yl)-N-prop-2-enylocta-2,6-dien-1-amine |
| SMILES | C=CCN(C/C=C(/C)CCC=C(C)C)C(=C)C=C(C)C |
| InChI | InChI=1S/C19H31N/c1-8-13-20(19(7)15-17(4)5)14-12-18(6)11-9-10-16(2)3/h8,10,12,15H,1,7,9,11,13-14H2,2-6H3/b18-12- |
| InChIKey | RPHQQSZKAMTQBH-PDGQHHTCSA-N |
| XLogP | 5.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|