About N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide
N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide (PubChem CID 88928085) has the molecular formula C14H25NO
and a molecular weight of 223.36 g/mol. Its IUPAC name is N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide.
Molecular Properties
| Compound Name | N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide |
| PubChem CID | 88928085 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide |
| SMILES | CC/C=C\CC/C=C(/C)CN(C=O)C(C)C |
| InChI | InChI=1S/C14H25NO/c1-5-6-7-8-9-10-14(4)11-15(12-16)13(2)3/h6-7,10,12-13H,5,8-9,11H2,1-4H3/b7-6-,14-10- |
| InChIKey | BCBYUGKGNQCKIC-FSGUHFLXSA-N |
| XLogP | 3.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide?
The IUPAC name of N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide (CID 88928085) is N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide.
What is the SMILES notation for N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide?
The canonical SMILES for N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide is CC/C=C\CC/C=C(/C)CN(C=O)C(C)C.
What is the InChIKey of N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide?
The InChIKey is BCBYUGKGNQCKIC-FSGUHFLXSA-N. The full InChI is InChI=1S/C14H25NO/c1-5-6-7-8-9-10-14(4)11-15(12-16)13(2)3/h6-7,10,12-13H,5,8-9,11H2,1-4H3/b7-6-,14-10-.
What are the key properties of N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide?
N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide has a molecular weight of 223.36 g/mol, XLogP of 3.55, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2Z,6Z)-2-methylnona-2,6-dienyl]-N-propan-2-ylformamide is sourced from PubChem (CID 88928085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).