About (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine
(2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine (PubChem CID 88928089) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine.
Molecular Properties
| Compound Name | (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine |
| PubChem CID | 88928089 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine |
| SMILES | C/C=C/C(C)NC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C15H27N/c1-6-8-15(5)16-12-11-14(4)10-7-9-13(2)3/h6,8-9,11,15-16H,7,10,12H2,1-5H3/b8-6+,14-11- |
| InChIKey | AWBTYUSRUBRCQK-SQKGQWCESA-N |
| XLogP | 4.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine?
The IUPAC name of (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine (CID 88928089) is (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine.
What is the SMILES notation for (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine?
The canonical SMILES for (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine is C/C=C/C(C)NC/C=C(/C)CCC=C(C)C.
What is the InChIKey of (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine?
The InChIKey is AWBTYUSRUBRCQK-SQKGQWCESA-N. The full InChI is InChI=1S/C15H27N/c1-6-8-15(5)16-12-11-14(4)10-7-9-13(2)3/h6,8-9,11,15-16H,7,10,12H2,1-5H3/b8-6+,14-11-.
What are the key properties of (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine?
(2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine has a molecular weight of 221.39 g/mol, XLogP of 4.23, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3,7-dimethyl-N-[(E)-pent-3-en-2-yl]octa-2,6-dien-1-amine is sourced from PubChem (CID 88928089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).