C19H37N — CID 88928144
N-butyl-2,3,3,7-tetramethyl-N-prop-2-enyloct-6-en-1-amine (PubChem CID 88928144) has the molecular formula C19H37N and a molecular weight of 279.51 g/mol. Its IUPAC name is N-butyl-2,3,3,7-tetramethyl-N-prop-2-enyloct-6-en-1-amine.
| Compound Name | N-butyl-2,3,3,7-tetramethyl-N-prop-2-enyloct-6-en-1-amine |
|---|---|
| PubChem CID | 88928144 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | N-butyl-2,3,3,7-tetramethyl-N-prop-2-enyloct-6-en-1-amine |
| SMILES | C=CCN(CCCC)CC(C)C(C)(C)CCC=C(C)C |
| InChI | InChI=1S/C19H37N/c1-8-10-15-20(14-9-2)16-18(5)19(6,7)13-11-12-17(3)4/h9,12,18H,2,8,10-11,13-16H2,1,3-7H3 |
| InChIKey | XPXRNRRJYPRZJL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|