About (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine
(2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine (PubChem CID 88928165) has the molecular formula C18H33N
and a molecular weight of 263.47 g/mol. Its IUPAC name is (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine.
Molecular Properties
| Compound Name | (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine |
| PubChem CID | 88928165 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine |
| SMILES | C=C(CCC)N(C/C=C(/C)CCC=C(C)C)C(C)C |
| InChI | InChI=1S/C18H33N/c1-8-10-18(7)19(16(4)5)14-13-17(6)12-9-11-15(2)3/h11,13,16H,7-10,12,14H2,1-6H3/b17-13- |
| InChIKey | RISYUQRXLYQEOM-LGMDPLHJSA-N |
| XLogP | 5.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine?
The IUPAC name of (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine (CID 88928165) is (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine.
What is the SMILES notation for (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine?
The canonical SMILES for (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine is C=C(CCC)N(C/C=C(/C)CCC=C(C)C)C(C)C.
What is the InChIKey of (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine?
The InChIKey is RISYUQRXLYQEOM-LGMDPLHJSA-N. The full InChI is InChI=1S/C18H33N/c1-8-10-18(7)19(16(4)5)14-13-17(6)12-9-11-15(2)3/h11,13,16H,7-10,12,14H2,1-6H3/b17-13-.
What are the key properties of (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine?
(2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine has a molecular weight of 263.47 g/mol, XLogP of 5.70, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-3,7-dimethyl-N-pent-1-en-2-yl-N-propan-2-ylocta-2,6-dien-1-amine is sourced from PubChem (CID 88928165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).