C21H35N — CID 88928199
(3Z)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4,8-dimethylnona-1,3,7-trien-2-amine (PubChem CID 88928199) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is (3Z)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4,8-dimethylnona-1,3,7-trien-2-amine.
| Compound Name | (3Z)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4,8-dimethylnona-1,3,7-trien-2-amine |
|---|---|
| PubChem CID | 88928199 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | (3Z)-N-[(2Z)-3,7-dimethylocta-2,6-dienyl]-4,8-dimethylnona-1,3,7-trien-2-amine |
| SMILES | C=C(/C=C(/C)CCC=C(C)C)NC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C21H35N/c1-17(2)10-8-12-19(5)14-15-22-21(7)16-20(6)13-9-11-18(3)4/h10-11,14,16,22H,7-9,12-13,15H2,1-6H3/b19-14-,20-16- |
| InChIKey | YUKDIGQBHYHIEW-BJPYRWADSA-N |
| XLogP | 6.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|