About (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine
(3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine (PubChem CID 88928211) has the molecular formula C16H27N
and a molecular weight of 233.40 g/mol. Its IUPAC name is (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine |
| PubChem CID | 88928211 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine |
| SMILES | C=C(/C=C/C)NCC1CC1(C)CCC=C(C)C |
| InChI | InChI=1S/C16H27N/c1-6-8-14(4)17-12-15-11-16(15,5)10-7-9-13(2)3/h6,8-9,15,17H,4,7,10-12H2,1-3,5H3/b8-6+ |
| InChIKey | FLTQHKASKMQATH-SOFGYWHQSA-N |
| XLogP | 4.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine?
The IUPAC name of (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine (CID 88928211) is (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine.
What is the SMILES notation for (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine?
The canonical SMILES for (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine is C=C(/C=C/C)NCC1CC1(C)CCC=C(C)C.
What is the InChIKey of (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine?
The InChIKey is FLTQHKASKMQATH-SOFGYWHQSA-N. The full InChI is InChI=1S/C16H27N/c1-6-8-14(4)17-12-15-11-16(15,5)10-7-9-13(2)3/h6,8-9,15,17H,4,7,10-12H2,1-3,5H3/b8-6+.
What are the key properties of (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine?
(3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine has a molecular weight of 233.40 g/mol, XLogP of 4.44, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N-[[2-methyl-2-(4-methylpent-3-enyl)cyclopropyl]methyl]penta-1,3-dien-2-amine is sourced from PubChem (CID 88928211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).