C21H21NO8 — CID 8892830
dimethyl 5-[3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyloxy]benzene-1,3-dicarboxylate (PubChem CID 8892830) has the molecular formula C21H21NO8 and a molecular weight of 415.40 g/mol. Its IUPAC name is dimethyl 5-[3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyloxy]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyloxy]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 8892830 |
| Molecular Formula | C21H21NO8 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.13 |
| IUPAC Name | dimethyl 5-[3-[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]propanoyloxy]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(OC(=O)CCN2C(=O)[C@H]3CC=CC[C@@H]3C2=O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H21NO8/c1-28-20(26)12-9-13(21(27)29-2)11-14(10-12)30-17(23)7-8-22-18(24)15-5-3-4-6-16(15)19(22)25/h3-4,9-11,15-16H,5-8H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | XDPWQEWTHINXFL-HOTGVXAUSA-N |
| XLogP | 1.51 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|