C28H43NO5 — CID 88928547
[(Z,2S)-5-[[4-[(2E,4E)-3-methyl-5-[(3S,4R,5R)-4-methyl-1,6-dioxaspiro[2.5]octan-5-yl]penta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 2-methylpropanoate (PubChem CID 88928547) has the molecular formula C28H43NO5 and a molecular weight of 473.65 g/mol. Its IUPAC name is [(Z,2S)-5-[[4-[(2E,4E)-3-methyl-5-[(3S,4R,5R)-4-methyl-1,6-dioxaspiro[2.5]octan-5-yl]penta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 2-methylpropanoate.
| Compound Name | [(Z,2S)-5-[[4-[(2E,4E)-3-methyl-5-[(3S,4R,5R)-4-methyl-1,6-dioxaspiro[2.5]octan-5-yl]penta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 88928547 |
| Molecular Formula | C28H43NO5 |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.31 |
| IUPAC Name | [(Z,2S)-5-[[4-[(2E,4E)-3-methyl-5-[(3S,4R,5R)-4-methyl-1,6-dioxaspiro[2.5]octan-5-yl]penta-2,4-dienyl]cyclohexyl]amino]-5-oxopent-3-en-2-yl] 2-methylpropanoate |
| SMILES | CC(/C=C/[C@H]1OCC[C@@]2(CO2)[C@@H]1C)=C\CC1CCC(NC(=O)/C=C\[C@H](C)OC(=O)C(C)C)CC1 |
| InChI | InChI=1S/C28H43NO5/c1-19(2)27(31)34-21(4)8-15-26(30)29-24-12-10-23(11-13-24)9-6-20(3)7-14-25-22(5)28(18-33-28)16-17-32-25/h6-8,14-15,19,21-25H,9-13,16-18H2,1-5H3,(H,29,30)/b14-7+,15-8-,20-6+/t21-,22+,23?,24?,25+,28+/m0/s1 |
| InChIKey | GKISASMWNDVFIK-GRFITDPGSA-N |
| XLogP | 4.89 |
| TPSA | 77.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|