C7H10O4 — CID 88928744
(3R,4R,5S)-4-hydroxy-1,6-dioxaspiro[2.5]octane-5-carbaldehyde (PubChem CID 88928744) has the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. Its IUPAC name is (3R,4R,5S)-4-hydroxy-1,6-dioxaspiro[2.5]octane-5-carbaldehyde.
| Compound Name | (3R,4R,5S)-4-hydroxy-1,6-dioxaspiro[2.5]octane-5-carbaldehyde |
|---|---|
| PubChem CID | 88928744 |
| Molecular Formula | C7H10O4 |
| Molecular Weight | 158.15 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | (3R,4R,5S)-4-hydroxy-1,6-dioxaspiro[2.5]octane-5-carbaldehyde |
| SMILES | O=C[C@H]1OCC[C@@]2(CO2)[C@@H]1O |
| InChI | InChI=1S/C7H10O4/c8-3-5-6(9)7(4-11-7)1-2-10-5/h3,5-6,9H,1-2,4H2/t5-,6-,7-/m1/s1 |
| InChIKey | VXTKACGLZKZCCG-FSDSQADBSA-N |
| XLogP | -0.90 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.15 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|