C23H23NO7S — CID 88929414
[(1S)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(3-methoxyphenyl)ethyl] 4-oxobutanoate (PubChem CID 88929414) has the molecular formula C23H23NO7S and a molecular weight of 457.50 g/mol. Its IUPAC name is [(1S)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(3-methoxyphenyl)ethyl] 4-oxobutanoate.
| Compound Name | [(1S)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(3-methoxyphenyl)ethyl] 4-oxobutanoate |
|---|---|
| PubChem CID | 88929414 |
| Molecular Formula | C23H23NO7S |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [(1S)-2-[4-[(2,4-dioxo-1,3-thiazolidin-5-yl)methyl]phenoxy]-1-(3-methoxyphenyl)ethyl] 4-oxobutanoate |
| SMILES | COc1cccc([C@@H](COc2ccc(CC3SC(=O)NC3=O)cc2)OC(=O)CCC=O)c1 |
| InChI | InChI=1S/C23H23NO7S/c1-29-18-5-2-4-16(13-18)19(31-21(26)6-3-11-25)14-30-17-9-7-15(8-10-17)12-20-22(27)24-23(28)32-20/h2,4-5,7-11,13,19-20H,3,6,12,14H2,1H3,(H,24,27,28)/t19-,20?/m1/s1 |
| InChIKey | NYOOSDFCCANOJS-FIWHBWSRSA-N |
| XLogP | 3.23 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|