C7H14O2 — CID 88929556
(1S)-2,2-dimethyl-1-[(2R)-oxiran-2-yl]propan-1-ol (PubChem CID 88929556) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is (1S)-2,2-dimethyl-1-[(2R)-oxiran-2-yl]propan-1-ol.
| Compound Name | (1S)-2,2-dimethyl-1-[(2R)-oxiran-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 88929556 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (1S)-2,2-dimethyl-1-[(2R)-oxiran-2-yl]propan-1-ol |
| SMILES | CC(C)(C)[C@H](O)[C@H]1CO1 |
| InChI | InChI=1S/C7H14O2/c1-7(2,3)6(8)5-4-9-5/h5-6,8H,4H2,1-3H3/t5-,6-/m1/s1 |
| InChIKey | QEKXTZAXJWVFRN-PHDIDXHHSA-N |
| XLogP | 0.79 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|