About 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane
2-cyclohexylsulfanylisoindole-1,3-dione;sulfane (PubChem CID 88930002) has the molecular formula C14H17NO2S2
and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane.
Molecular Properties
| Compound Name | 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane |
| PubChem CID | 88930002 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane |
| SMILES | O=C1c2ccccc2C(=O)N1SC1CCCCC1.S |
| InChI | InChI=1S/C14H15NO2S.H2S/c16-13-11-8-4-5-9-12(11)14(17)15(13)18-10-6-2-1-3-7-10;/h4-5,8-10H,1-3,6-7H2;1H2 |
| InChIKey | QFOWRFRMLYGOQN-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane?
The IUPAC name of 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane (CID 88930002) is 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane.
What is the SMILES notation for 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane?
The canonical SMILES for 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane is O=C1c2ccccc2C(=O)N1SC1CCCCC1.S.
What is the InChIKey of 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane?
The InChIKey is QFOWRFRMLYGOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2S.H2S/c16-13-11-8-4-5-9-12(11)14(17)15(13)18-10-6-2-1-3-7-10;/h4-5,8-10H,1-3,6-7H2;1H2.
What are the key properties of 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane?
2-cyclohexylsulfanylisoindole-1,3-dione;sulfane has a molecular weight of 295.43 g/mol, XLogP of 3.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylsulfanylisoindole-1,3-dione;sulfane is sourced from PubChem (CID 88930002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).