C26H25Cl2N3O4 — CID 88930129
methyl 4-[(1E,3E)-1-amino-2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)hexa-1,3,5-trien-3-yl]oxy-2,5-dichlorobenzoate (PubChem CID 88930129) has the molecular formula C26H25Cl2N3O4 and a molecular weight of 514.41 g/mol. Its IUPAC name is methyl 4-[(1E,3E)-1-amino-2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)hexa-1,3,5-trien-3-yl]oxy-2,5-dichlorobenzoate.
| Compound Name | methyl 4-[(1E,3E)-1-amino-2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)hexa-1,3,5-trien-3-yl]oxy-2,5-dichlorobenzoate |
|---|---|
| PubChem CID | 88930129 |
| Molecular Formula | C26H25Cl2N3O4 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | methyl 4-[(1E,3E)-1-amino-2-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)hexa-1,3,5-trien-3-yl]oxy-2,5-dichlorobenzoate |
| SMILES | C=C/C=C(Oc1cc(Cl)c(C(=O)OC)cc1Cl)\C(=C/N)C(=O)N1CCN(C2CC2)c2ccccc21 |
| InChI | InChI=1S/C26H25Cl2N3O4/c1-3-6-23(35-24-14-19(27)17(13-20(24)28)26(33)34-2)18(15-29)25(32)31-12-11-30(16-9-10-16)21-7-4-5-8-22(21)31/h3-8,13-16H,1,9-12,29H2,2H3/b18-15+,23-6+ |
| InChIKey | CBKWXOLHHKWMQR-PQVRPFCFSA-N |
| XLogP | 5.09 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|