C21H30O6 — CID 88930292
(4S,5S)-5-[(1S,2S,4S,5R,6S,7R)-5,6-dihydroxy-5-methyl-7-propan-2-yl-3,8-dioxatricyclo[5.1.0.02,4]octan-4-yl]-4-ethyl-5-methyl-3,4,6,7-tetrahydro-2-benzofuran-1-one (PubChem CID 88930292) has the molecular formula C21H30O6 and a molecular weight of 378.47 g/mol. Its IUPAC name is (4S,5S)-5-[(1S,2S,4S,5R,6S,7R)-5,6-dihydroxy-5-methyl-7-propan-2-yl-3,8-dioxatricyclo[5.1.0.02,4]octan-4-yl]-4-ethyl-5-methyl-3,4,6,7-tetrahydro-2-benzofuran-1-one.
| Compound Name | (4S,5S)-5-[(1S,2S,4S,5R,6S,7R)-5,6-dihydroxy-5-methyl-7-propan-2-yl-3,8-dioxatricyclo[5.1.0.02,4]octan-4-yl]-4-ethyl-5-methyl-3,4,6,7-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 88930292 |
| Molecular Formula | C21H30O6 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | (4S,5S)-5-[(1S,2S,4S,5R,6S,7R)-5,6-dihydroxy-5-methyl-7-propan-2-yl-3,8-dioxatricyclo[5.1.0.02,4]octan-4-yl]-4-ethyl-5-methyl-3,4,6,7-tetrahydro-2-benzofuran-1-one |
| SMILES | CC[C@H]1C2=C(CC[C@]1(C)[C@]13O[C@H]1[C@@H]1O[C@]1(C(C)C)[C@@H](O)[C@@]3(C)O)C(=O)OC2 |
| InChI | InChI=1S/C21H30O6/c1-6-13-12-9-25-16(22)11(12)7-8-18(13,4)21-15(27-21)14-20(26-14,10(2)3)17(23)19(21,5)24/h10,13-15,17,23-24H,6-9H2,1-5H3/t13-,14-,15-,17-,18-,19+,20-,21+/m0/s1 |
| InChIKey | PAHBYLWEYUAOAX-PXECCSRGSA-N |
| XLogP | 1.72 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|