About 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate
7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate (PubChem CID 88930431) has the molecular formula C17H28O5
and a molecular weight of 312.41 g/mol. Its IUPAC name is 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate.
Molecular Properties
| Compound Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate |
| PubChem CID | 88930431 |
| Molecular Formula | C17H28O5 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate |
| SMILES | CC(CC(=O)OCC1CCC2OC2C1)CC(C)(C)COC=O |
| InChI | InChI=1S/C17H28O5/c1-12(8-17(2,3)10-20-11-18)6-16(19)21-9-13-4-5-14-15(7-13)22-14/h11-15H,4-10H2,1-3H3 |
| InChIKey | MTNNGBFZBRIVKO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate?
The IUPAC name of 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate (CID 88930431) is 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate.
What is the SMILES notation for 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate?
The canonical SMILES for 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate is CC(CC(=O)OCC1CCC2OC2C1)CC(C)(C)COC=O.
What is the InChIKey of 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate?
The InChIKey is MTNNGBFZBRIVKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O5/c1-12(8-17(2,3)10-20-11-18)6-16(19)21-9-13-4-5-14-15(7-13)22-14/h11-15H,4-10H2,1-3H3.
What are the key properties of 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate?
7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate has a molecular weight of 312.41 g/mol, XLogP of 2.71, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-oxabicyclo[4.1.0]heptan-3-ylmethyl 6-formyloxy-3,5,5-trimethylhexanoate is sourced from PubChem (CID 88930431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).