C23H22BN — CID 88930604
CID 88930604 (PubChem CID 88930604) has the molecular formula C23H22BN and a molecular weight of 323.25 g/mol.
| Compound Name | CID 88930604 |
|---|---|
| PubChem CID | 88930604 |
| Molecular Formula | C23H22BN |
| Molecular Weight | 323.25 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H22BN/c1-15-5-11-21-19(13-15)20-14-17(24)8-12-22(20)25(21)18-9-6-16(7-10-18)23(2,3)4/h5-14H,1-4H3 |
| InChIKey | QCUNWCNVDVRNGU-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|