C12H22N2O3 — CID 88930619
(E,2S,3R,4R)-2-[acetyl(methyl)amino]-3-hydroxy-N,4-dimethylhept-5-enamide (PubChem CID 88930619) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is (E,2S,3R,4R)-2-[acetyl(methyl)amino]-3-hydroxy-N,4-dimethylhept-5-enamide.
| Compound Name | (E,2S,3R,4R)-2-[acetyl(methyl)amino]-3-hydroxy-N,4-dimethylhept-5-enamide |
|---|---|
| PubChem CID | 88930619 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | (E,2S,3R,4R)-2-[acetyl(methyl)amino]-3-hydroxy-N,4-dimethylhept-5-enamide |
| SMILES | C/C=C/[C@@H](C)[C@@H](O)[C@@H](C(=O)NC)N(C)C(C)=O |
| InChI | InChI=1S/C12H22N2O3/c1-6-7-8(2)11(16)10(12(17)13-4)14(5)9(3)15/h6-8,10-11,16H,1-5H3,(H,13,17)/b7-6+/t8-,10+,11-/m1/s1 |
| InChIKey | YLSATLAEFCWAGY-HYVPQEEESA-N |
| XLogP | 0.15 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|