C11H7F6NO2S — CID 88930774
S-[2-[methyl-(2,2,2-trifluoroacetyl)amino]phenyl] 2,2,2-trifluoroethanethioate (PubChem CID 88930774) has the molecular formula C11H7F6NO2S and a molecular weight of 331.24 g/mol. Its IUPAC name is S-[2-[methyl-(2,2,2-trifluoroacetyl)amino]phenyl] 2,2,2-trifluoroethanethioate.
| Compound Name | S-[2-[methyl-(2,2,2-trifluoroacetyl)amino]phenyl] 2,2,2-trifluoroethanethioate |
|---|---|
| PubChem CID | 88930774 |
| Molecular Formula | C11H7F6NO2S |
| Molecular Weight | 331.24 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | S-[2-[methyl-(2,2,2-trifluoroacetyl)amino]phenyl] 2,2,2-trifluoroethanethioate |
| SMILES | CN(C(=O)C(F)(F)F)c1ccccc1SC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H7F6NO2S/c1-18(8(19)10(12,13)14)6-4-2-3-5-7(6)21-9(20)11(15,16)17/h2-5H,1H3 |
| InChIKey | JZLXZSXJAMQTIB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|