C16H28O4 — CID 88930954
(2S,3S,4R)-4-hydroxy-2-methoxy-4-methyl-3-[(3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]cyclohexan-1-one (PubChem CID 88930954) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2S,3S,4R)-4-hydroxy-2-methoxy-4-methyl-3-[(3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]cyclohexan-1-one.
| Compound Name | (2S,3S,4R)-4-hydroxy-2-methoxy-4-methyl-3-[(3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 88930954 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | (2S,3S,4R)-4-hydroxy-2-methoxy-4-methyl-3-[(3R)-2-methyl-3-(3-methylbutyl)oxiran-2-yl]cyclohexan-1-one |
| SMILES | CO[C@@H]1C(=O)CC[C@@](C)(O)[C@H]1C1(C)O[C@@H]1CCC(C)C |
| InChI | InChI=1S/C16H28O4/c1-10(2)6-7-12-16(4,20-12)14-13(19-5)11(17)8-9-15(14,3)18/h10,12-14,18H,6-9H2,1-5H3/t12-,13-,14+,15-,16?/m1/s1 |
| InChIKey | MGNIHGWEKKUKRR-IWQYDBTJSA-N |
| XLogP | 2.33 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|