C22H38O4Si — CID 88930959
hydroxy-[1-[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]-2-methylpropan-2-yl]-dimethylsilane (PubChem CID 88930959) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is hydroxy-[1-[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]-2-methylpropan-2-yl]-dimethylsilane.
| Compound Name | hydroxy-[1-[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]-2-methylpropan-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 88930959 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | hydroxy-[1-[(3R,4S,5S)-5-methoxy-4-[(3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-oxaspiro[2.5]oct-6-en-6-yl]-2-methylpropan-2-yl]-dimethylsilane |
| SMILES | CO[C@@H]1C(CC(C)(C)[Si](C)(C)O)=CC[C@]2(CO2)[C@H]1C1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C22H38O4Si/c1-15(2)9-10-17-21(5,26-17)19-18(24-6)16(11-12-22(19)14-25-22)13-20(3,4)27(7,8)23/h9,11,17-19,23H,10,12-14H2,1-8H3/t17-,18-,19-,21?,22+/m1/s1 |
| InChIKey | MCCXTPWBYAAUEF-IWOVDKSMSA-N |
| XLogP | 4.60 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|