C31H37Cl2FN4O3 — CID 88931116
CID 88931116 (PubChem CID 88931116) has the molecular formula C31H37Cl2FN4O3 and a molecular weight of 603.57 g/mol.
| Compound Name | CID 88931116 |
|---|---|
| PubChem CID | 88931116 |
| Molecular Formula | C31H37Cl2FN4O3 |
| Molecular Weight | 603.57 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | — |
| SMILES | CC1(C)CCC2(CC1)N[C@@H](C(=O)NC1CCC(CO)CC1)[C@H](c1ccnc(Cl)c1F)[C@]21C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C31H37Cl2FN4O3/c1-29(2)10-12-30(13-11-29)31(21-8-5-18(32)15-22(21)37-28(31)41)23(20-9-14-35-26(33)24(20)34)25(38-30)27(40)36-19-6-3-17(16-39)4-7-19/h5,8-9,14-15,17,19,23,25,38-39H,3-4,6-7,10-13,16H2,1-2H3,(H,36,40)(H,37,41)/t17?,19?,23-,25+,31+/m0/s1 |
| InChIKey | NMFKGBXPSHKDRO-PDCAPKHWSA-N |
| XLogP | 5.48 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.57 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|