C22H37FN6O2S — CID 88931277
(4aR,6R,8aR)-2,3-diamino-N-[2-(dimethylamino)ethylcarbamoyl]-8-(2-fluoroethyl)-N-propyl-4a,5,6,7,8a,9-hexahydro-4H-thieno[3,2-g]quinoline-6-carboxamide (PubChem CID 88931277) has the molecular formula C22H37FN6O2S and a molecular weight of 468.64 g/mol. Its IUPAC name is (4aR,6R,8aR)-2,3-diamino-N-[2-(dimethylamino)ethylcarbamoyl]-8-(2-fluoroethyl)-N-propyl-4a,5,6,7,8a,9-hexahydro-4H-thieno[3,2-g]quinoline-6-carboxamide.
| Compound Name | (4aR,6R,8aR)-2,3-diamino-N-[2-(dimethylamino)ethylcarbamoyl]-8-(2-fluoroethyl)-N-propyl-4a,5,6,7,8a,9-hexahydro-4H-thieno[3,2-g]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 88931277 |
| Molecular Formula | C22H37FN6O2S |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | (4aR,6R,8aR)-2,3-diamino-N-[2-(dimethylamino)ethylcarbamoyl]-8-(2-fluoroethyl)-N-propyl-4a,5,6,7,8a,9-hexahydro-4H-thieno[3,2-g]quinoline-6-carboxamide |
| SMILES | CCCN(C(=O)NCCN(C)C)C(=O)[C@@H]1C[C@@H]2Cc3c(sc(N)c3N)C[C@H]2N(CCF)C1 |
| InChI | InChI=1S/C22H37FN6O2S/c1-4-7-29(22(31)26-6-9-27(2)3)21(30)15-10-14-11-16-18(32-20(25)19(16)24)12-17(14)28(13-15)8-5-23/h14-15,17H,4-13,24-25H2,1-3H3,(H,26,31)/t14-,15-,17-/m1/s1 |
| InChIKey | DJGJZRINLNPKSA-BFYDXBDKSA-N |
| XLogP | 1.80 |
| TPSA | 107.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |