C24H4Br4F6N4 — CID 88931427
10,15,21,25-tetrabromo-7,18-bis(trifluoromethyl)-6,8,17,19-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),6,8,10,12,14,16,18,20,23-tridecaene (PubChem CID 88931427) has the molecular formula C24H4Br4F6N4 and a molecular weight of 781.93 g/mol. Its IUPAC name is 10,15,21,25-tetrabromo-7,18-bis(trifluoromethyl)-6,8,17,19-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),6,8,10,12,14,16,18,20,23-tridecaene.
| Compound Name | 10,15,21,25-tetrabromo-7,18-bis(trifluoromethyl)-6,8,17,19-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),6,8,10,12,14,16,18,20,23-tridecaene |
|---|---|
| PubChem CID | 88931427 |
| Molecular Formula | C24H4Br4F6N4 |
| Molecular Weight | 781.93 g/mol |
| Exact Mass | 777.71 |
| IUPAC Name | 10,15,21,25-tetrabromo-7,18-bis(trifluoromethyl)-6,8,17,19-tetrazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(22),2(26),3,5(25),6,8,10,12,14,16,18,20,23-tridecaene |
| SMILES | FC(F)(F)c1nc2c(Br)cc3c4cc(Br)c5nc(C(F)(F)F)nc6c(Br)cc(c7cc(Br)c(n1)c2c37)c4c56 |
| InChI | InChI=1S/C24H4Br4F6N4/c25-9-1-5-6-2-10(26)19-16-14(6)8(4-12(28)20(16)38-22(37-19)24(32,33)34)7-3-11(27)18-15(13(5)7)17(9)35-21(36-18)23(29,30)31/h1-4H |
| InChIKey | PYOPILUKHDJZTP-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 781.93 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|