C19H23NO5 — CID 88931547
N-benzyl-2-[(2R)-3-[(3R,4S,5S)-5-hydroxy-6-oxo-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]acetamide (PubChem CID 88931547) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-benzyl-2-[(2R)-3-[(3R,4S,5S)-5-hydroxy-6-oxo-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]acetamide.
| Compound Name | N-benzyl-2-[(2R)-3-[(3R,4S,5S)-5-hydroxy-6-oxo-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]acetamide |
|---|---|
| PubChem CID | 88931547 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-benzyl-2-[(2R)-3-[(3R,4S,5S)-5-hydroxy-6-oxo-1-oxaspiro[2.5]octan-4-yl]-3-methyloxiran-2-yl]acetamide |
| SMILES | CC1([C@H]2[C@H](O)C(=O)CC[C@]23CO3)O[C@@H]1CC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C19H23NO5/c1-18(17-16(23)13(21)7-8-19(17)11-24-19)14(25-18)9-15(22)20-10-12-5-3-2-4-6-12/h2-6,14,16-17,23H,7-11H2,1H3,(H,20,22)/t14-,16-,17-,18?,19+/m1/s1 |
| InChIKey | GGWJCEOREVBCRM-MIHUCIJVSA-N |
| XLogP | 0.96 |
| TPSA | 91.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|