C12H20F2O2 — CID 88931578
2,2-difluoro-2-(1-hydroxy-3,3,5,5-tetramethylcyclohexyl)acetaldehyde (PubChem CID 88931578) has the molecular formula C12H20F2O2 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2,2-difluoro-2-(1-hydroxy-3,3,5,5-tetramethylcyclohexyl)acetaldehyde.
| Compound Name | 2,2-difluoro-2-(1-hydroxy-3,3,5,5-tetramethylcyclohexyl)acetaldehyde |
|---|---|
| PubChem CID | 88931578 |
| Molecular Formula | C12H20F2O2 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2,2-difluoro-2-(1-hydroxy-3,3,5,5-tetramethylcyclohexyl)acetaldehyde |
| SMILES | CC1(C)CC(C)(C)CC(O)(C(F)(F)C=O)C1 |
| InChI | InChI=1S/C12H20F2O2/c1-9(2)5-10(3,4)7-11(16,6-9)12(13,14)8-15/h8,16H,5-7H2,1-4H3 |
| InChIKey | ADUSJFKVPORXKD-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|