C22H37NO3 — CID 88931717
tert-butyl N-[(2R,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-N-[2-(2-methylprop-2-enoxy)butyl]carbamate (PubChem CID 88931717) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is tert-butyl N-[(2R,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-N-[2-(2-methylprop-2-enoxy)butyl]carbamate.
| Compound Name | tert-butyl N-[(2R,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-N-[2-(2-methylprop-2-enoxy)butyl]carbamate |
|---|---|
| PubChem CID | 88931717 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | tert-butyl N-[(2R,3E,4Z)-3-ethylidenehepta-4,6-dien-2-yl]-N-[2-(2-methylprop-2-enoxy)butyl]carbamate |
| SMILES | C=C/C=C\C(=C/C)[C@@H](C)N(CC(CC)OCC(=C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37NO3/c1-10-13-14-19(11-2)18(6)23(21(24)26-22(7,8)9)15-20(12-3)25-16-17(4)5/h10-11,13-14,18,20H,1,4,12,15-16H2,2-3,5-9H3/b14-13-,19-11+/t18-,20?/m1/s1 |
| InChIKey | JTDGVPJHOZRLNR-LNMZUBPGSA-N |
| XLogP | 5.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|