About CID 88931759
CID 88931759 (PubChem CID 88931759) has the molecular formula C36H28Cl2F3N3O3
and a molecular weight of 678.54 g/mol.
Molecular Properties
| Compound Name | CID 88931759 |
| PubChem CID | 88931759 |
| Molecular Formula | C36H28Cl2F3N3O3 |
| Molecular Weight | 678.54 g/mol |
| Exact Mass | 677.15 |
| IUPAC Name | — |
| SMILES | O=C1O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N2[C@@H]1[C@H](c1ccnc(Cl)c1)[C@@]1(C(=O)Nc3cc(Cl)c(F)cc31)C21CC(CF)(CF)C1 |
| InChI | InChI=1S/C36H28Cl2F3N3O3/c37-24-15-26-23(14-25(24)41)36(33(46)43-26)28(22-11-12-42-27(38)13-22)30-32(45)47-31(21-9-5-2-6-10-21)29(20-7-3-1-4-8-20)44(30)35(36)16-34(17-35,18-39)19-40/h1-15,28-31H,16-19H2,(H,43,46)/t28-,29+,30+,31-,36-/m0/s1 |
| InChIKey | TYYIXBNQPDQVTI-NHWVHFTKSA-N |
| XLogP | 7.68 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 678.54 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze CID 88931759 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88931759?
The IUPAC name of CID 88931759 (CID 88931759) is not available.
What is the SMILES notation for CID 88931759?
The canonical SMILES for CID 88931759 is O=C1O[C@@H](c2ccccc2)[C@@H](c2ccccc2)N2[C@@H]1[C@H](c1ccnc(Cl)c1)[C@@]1(C(=O)Nc3cc(Cl)c(F)cc31)C21CC(CF)(CF)C1.
What is the InChIKey of CID 88931759?
The InChIKey is TYYIXBNQPDQVTI-NHWVHFTKSA-N. The full InChI is InChI=1S/C36H28Cl2F3N3O3/c37-24-15-26-23(14-25(24)41)36(33(46)43-26)28(22-11-12-42-27(38)13-22)30-32(45)47-31(21-9-5-2-6-10-21)29(20-7-3-1-4-8-20)44(30)35(36)16-34(17-35,18-39)19-40/h1-15,28-31H,16-19H2,(H,43,46)/t28-,29+,30+,31-,36-/m0/s1.
What are the key properties of CID 88931759?
CID 88931759 has a molecular weight of 678.54 g/mol, XLogP of 7.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88931759 is sourced from PubChem (CID 88931759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).