C24H41NO4 — CID 88931828
tert-butyl N-[(2R,3E,4E)-3-ethylidene-5-methoxy-6-methylhepta-4,6-dien-2-yl]-N-[2-(2-methylprop-2-enoxy)butyl]carbamate (PubChem CID 88931828) has the molecular formula C24H41NO4 and a molecular weight of 407.60 g/mol. Its IUPAC name is tert-butyl N-[(2R,3E,4E)-3-ethylidene-5-methoxy-6-methylhepta-4,6-dien-2-yl]-N-[2-(2-methylprop-2-enoxy)butyl]carbamate.
| Compound Name | tert-butyl N-[(2R,3E,4E)-3-ethylidene-5-methoxy-6-methylhepta-4,6-dien-2-yl]-N-[2-(2-methylprop-2-enoxy)butyl]carbamate |
|---|---|
| PubChem CID | 88931828 |
| Molecular Formula | C24H41NO4 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.30 |
| IUPAC Name | tert-butyl N-[(2R,3E,4E)-3-ethylidene-5-methoxy-6-methylhepta-4,6-dien-2-yl]-N-[2-(2-methylprop-2-enoxy)butyl]carbamate |
| SMILES | C=C(C)COC(CC)CN(C(=O)OC(C)(C)C)[C@H](C)C(/C=C(\OC)C(=C)C)=C/C |
| InChI | InChI=1S/C24H41NO4/c1-12-20(14-22(27-11)18(5)6)19(7)25(23(26)29-24(8,9)10)15-21(13-2)28-16-17(3)4/h12,14,19,21H,3,5,13,15-16H2,1-2,4,6-11H3/b20-12-,22-14+/t19-,21?/m1/s1 |
| InChIKey | BIZRAIOFSZSJDS-SPEQDHRFSA-N |
| XLogP | 6.04 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|