C10H18O2S — CID 88931876
3-[(2S,3S,5R,6S)-3,5-dimethyl-6-sulfanyloxan-2-yl]propanal (PubChem CID 88931876) has the molecular formula C10H18O2S and a molecular weight of 202.32 g/mol. Its IUPAC name is 3-[(2S,3S,5R,6S)-3,5-dimethyl-6-sulfanyloxan-2-yl]propanal.
| Compound Name | 3-[(2S,3S,5R,6S)-3,5-dimethyl-6-sulfanyloxan-2-yl]propanal |
|---|---|
| PubChem CID | 88931876 |
| Molecular Formula | C10H18O2S |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 3-[(2S,3S,5R,6S)-3,5-dimethyl-6-sulfanyloxan-2-yl]propanal |
| SMILES | C[C@@H]1C[C@H](C)[C@H](CCC=O)O[C@H]1S |
| InChI | InChI=1S/C10H18O2S/c1-7-6-8(2)10(13)12-9(7)4-3-5-11/h5,7-10,13H,3-4,6H2,1-2H3/t7-,8+,9-,10-/m0/s1 |
| InChIKey | RKYIOFBQSAJQDT-JXUBOQSCSA-N |
| XLogP | 2.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|