C16H18F3N5O2S — CID 88931955
(5Z)-5-[[2-[4-(methylaminomethyl)piperidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 88931955) has the molecular formula C16H18F3N5O2S and a molecular weight of 401.41 g/mol. Its IUPAC name is (5Z)-5-[[2-[4-(methylaminomethyl)piperidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[2-[4-(methylaminomethyl)piperidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 88931955 |
| Molecular Formula | C16H18F3N5O2S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (5Z)-5-[[2-[4-(methylaminomethyl)piperidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CNCC1CCN(c2nc(/C=C3\SC(=O)NC3=O)cc(C(F)(F)F)n2)CC1 |
| InChI | InChI=1S/C16H18F3N5O2S/c1-20-8-9-2-4-24(5-3-9)14-21-10(7-12(22-14)16(17,18)19)6-11-13(25)23-15(26)27-11/h6-7,9,20H,2-5,8H2,1H3,(H,23,25,26)/b11-6- |
| InChIKey | CGHQHIPONODTBN-WDZFZDKYSA-N |
| XLogP | 2.26 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|